C13H10N6 — CID 135427226
5-methyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine (PubChem CID 135427226) has the molecular formula C13H10N6 and a molecular weight of 250.27 g/mol. Its IUPAC name is 5-methyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine.
| Compound Name | 5-methyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine |
|---|---|
| PubChem CID | 135427226 |
| Molecular Formula | C13H10N6 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-methyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine |
| SMILES | Cc1nc2nc[nH]c2c2nc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C13H10N6/c1-8-16-12-10(14-7-15-12)13-17-11(18-19(8)13)9-5-3-2-4-6-9/h2-7H,1H3,(H,14,15) |
| InChIKey | MGPAPZZAOLVOQS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |