C16H11N3O5S — CID 135427952
2-(3-benzamidothiophen-2-yl)-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid (PubChem CID 135427952) has the molecular formula C16H11N3O5S and a molecular weight of 357.35 g/mol. Its IUPAC name is 2-(3-benzamidothiophen-2-yl)-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 2-(3-benzamidothiophen-2-yl)-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135427952 |
| Molecular Formula | C16H11N3O5S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-(3-benzamidothiophen-2-yl)-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(Nc1ccsc1-c1nc(C(=O)O)c(O)c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C16H11N3O5S/c20-11-10(16(23)24)18-13(19-15(11)22)12-9(6-7-25-12)17-14(21)8-4-2-1-3-5-8/h1-7,20H,(H,17,21)(H,23,24)(H,18,19,22) |
| InChIKey | VRUFAVXVBJJZDM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |