C17H14N4O5S — CID 136647639
[2-[4-(benzylcarbamoyl)-5-hydroxy-6-oxo-1H-pyrimidin-2-yl]thiophen-3-yl]carbamic acid (PubChem CID 136647639) has the molecular formula C17H14N4O5S and a molecular weight of 386.39 g/mol. Its IUPAC name is [2-[4-(benzylcarbamoyl)-5-hydroxy-6-oxo-1H-pyrimidin-2-yl]thiophen-3-yl]carbamic acid.
| Compound Name | [2-[4-(benzylcarbamoyl)-5-hydroxy-6-oxo-1H-pyrimidin-2-yl]thiophen-3-yl]carbamic acid |
|---|---|
| PubChem CID | 136647639 |
| Molecular Formula | C17H14N4O5S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | [2-[4-(benzylcarbamoyl)-5-hydroxy-6-oxo-1H-pyrimidin-2-yl]thiophen-3-yl]carbamic acid |
| SMILES | O=C(O)Nc1ccsc1-c1nc(C(=O)NCc2ccccc2)c(O)c(=O)[nH]1 |
| InChI | InChI=1S/C17H14N4O5S/c22-12-11(15(23)18-8-9-4-2-1-3-5-9)20-14(21-16(12)24)13-10(6-7-27-13)19-17(25)26/h1-7,19,22H,8H2,(H,18,23)(H,25,26)(H,20,21,24) |
| InChIKey | SIHOVPKFWHHEOV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |