C14H11N3O4S — CID 135601905
N-(furan-2-ylmethyl)-5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide (PubChem CID 135601905) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 135601905 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-hydroxy-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1ccco1)c1nc(-c2cccs2)[nH]c(=O)c1O |
| InChI | InChI=1S/C14H11N3O4S/c18-11-10(13(19)15-7-8-3-1-5-21-8)16-12(17-14(11)20)9-4-2-6-22-9/h1-6,18H,7H2,(H,15,19)(H,16,17,20) |
| InChIKey | JPXYQAVBHDQDNT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |