C14H10N4O4S2 — CID 142236196
5-hydroxy-N-[(3-methanethioyl-1,2-oxazol-5-yl)methyl]-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide (PubChem CID 142236196) has the molecular formula C14H10N4O4S2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 5-hydroxy-N-[(3-methanethioyl-1,2-oxazol-5-yl)methyl]-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide.
| Compound Name | 5-hydroxy-N-[(3-methanethioyl-1,2-oxazol-5-yl)methyl]-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 142236196 |
| Molecular Formula | C14H10N4O4S2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 5-hydroxy-N-[(3-methanethioyl-1,2-oxazol-5-yl)methyl]-6-oxo-2-thiophen-2-yl-1H-pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1cc(C=S)no1)c1nc(-c2cccs2)[nH]c(=O)c1O |
| InChI | InChI=1S/C14H10N4O4S2/c19-11-10(13(20)15-5-8-4-7(6-23)18-22-8)16-12(17-14(11)21)9-2-1-3-24-9/h1-4,6,19H,5H2,(H,15,20)(H,16,17,21) |
| InChIKey | VOMONNHLJDHTAE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|