C20H17N5O3S — CID 135427983
4-[2-[4-(1-methylimidazol-2-yl)sulfonylanilino]pyrimidin-4-yl]phenol (PubChem CID 135427983) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is 4-[2-[4-(1-methylimidazol-2-yl)sulfonylanilino]pyrimidin-4-yl]phenol.
| Compound Name | 4-[2-[4-(1-methylimidazol-2-yl)sulfonylanilino]pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 135427983 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-[2-[4-(1-methylimidazol-2-yl)sulfonylanilino]pyrimidin-4-yl]phenol |
| SMILES | Cn1ccnc1S(=O)(=O)c1ccc(Nc2nccc(-c3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C20H17N5O3S/c1-25-13-12-22-20(25)29(27,28)17-8-4-15(5-9-17)23-19-21-11-10-18(24-19)14-2-6-16(26)7-3-14/h2-13,26H,1H3,(H,21,23,24) |
| InChIKey | GVIBHKYNYIOGCG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |