C11H11NO4S — CID 135428664
(4S)-2-(2,5-dihydroxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid (PubChem CID 135428664) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is (4S)-2-(2,5-dihydroxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-(2,5-dihydroxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 135428664 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | (4S)-2-(2,5-dihydroxyphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CSC(c2cc(O)ccc2O)=N1 |
| InChI | InChI=1S/C11H11NO4S/c1-11(10(15)16)5-17-9(12-11)7-4-6(13)2-3-8(7)14/h2-4,13-14H,5H2,1H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | ZGWGIYLDFQYMED-LLVKDONJSA-N |
| XLogP | 1.43 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|