C12H13N3O2 — CID 135429894
ethyl 4-amino-1H-1,5-benzodiazepine-3-carboxylate (PubChem CID 135429894) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is ethyl 4-amino-1H-1,5-benzodiazepine-3-carboxylate.
| Compound Name | ethyl 4-amino-1H-1,5-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 135429894 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | ethyl 4-amino-1H-1,5-benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1=CNc2ccccc2N=C1N |
| InChI | InChI=1S/C12H13N3O2/c1-2-17-12(16)8-7-14-9-5-3-4-6-10(9)15-11(8)13/h3-7,14H,2H2,1H3,(H2,13,15) |
| InChIKey | JQUOUDGGGAKTDU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |