C13H15N3O2 — CID 3671479
ethyl 4-amino-2-methyl-1H-1,5-benzodiazepine-3-carboxylate (PubChem CID 3671479) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 4-amino-2-methyl-1H-1,5-benzodiazepine-3-carboxylate.
| Compound Name | ethyl 4-amino-2-methyl-1H-1,5-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 3671479 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | ethyl 4-amino-2-methyl-1H-1,5-benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2ccccc2N=C1N |
| InChI | InChI=1S/C13H15N3O2/c1-3-18-13(17)11-8(2)15-9-6-4-5-7-10(9)16-12(11)14/h4-7,15H,3H2,1-2H3,(H2,14,16) |
| InChIKey | GPILVEXLISFHOO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |