C19H20N2O3 — CID 135496505
ethyl 2-(N,N'-diphenylcarbamimidoyl)-3-hydroxybut-2-enoate (PubChem CID 135496505) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is ethyl 2-(N,N'-diphenylcarbamimidoyl)-3-hydroxybut-2-enoate.
| Compound Name | ethyl 2-(N,N'-diphenylcarbamimidoyl)-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135496505 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | ethyl 2-(N,N'-diphenylcarbamimidoyl)-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(=C(C)O)/C(=N\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C19H20N2O3/c1-3-24-19(23)17(14(2)22)18(20-15-10-6-4-7-11-15)21-16-12-8-5-9-13-16/h4-13,22H,3H2,1-2H3,(H,20,21) |
| InChIKey | SHRDBBJQYMVDPX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|