C12H13F2N3O2 — CID 169172916
ethyl (E)-3-amino-2-[N'-(2,4-difluorophenyl)carbamimidoyl]prop-2-enoate (PubChem CID 169172916) has the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. Its IUPAC name is ethyl (E)-3-amino-2-[N'-(2,4-difluorophenyl)carbamimidoyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-amino-2-[N'-(2,4-difluorophenyl)carbamimidoyl]prop-2-enoate |
|---|---|
| PubChem CID | 169172916 |
| Molecular Formula | C12H13F2N3O2 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | ethyl (E)-3-amino-2-[N'-(2,4-difluorophenyl)carbamimidoyl]prop-2-enoate |
| SMILES | CCOC(=O)C(=C/N)/C(N)=N/c1ccc(F)cc1F |
| InChI | InChI=1S/C12H13F2N3O2/c1-2-19-12(18)8(6-15)11(16)17-10-4-3-7(13)5-9(10)14/h3-6H,2,15H2,1H3,(H2,16,17)/b8-6+ |
| InChIKey | OIXJFETZIOJVIA-SOFGYWHQSA-N |
| XLogP | 1.36 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|