C20H22N2O4 — CID 135430560
(5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol (PubChem CID 135430560) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol.
| Compound Name | (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol |
|---|---|
| PubChem CID | 135430560 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol |
| SMILES | CC[C@H]1C(C)=NN=C(c2ccc(OC)c(O)c2)c2cc(OC)c(O)cc21 |
| InChI | InChI=1S/C20H22N2O4/c1-5-13-11(2)21-22-20(12-6-7-18(25-3)16(23)8-12)15-10-19(26-4)17(24)9-14(13)15/h6-10,13,23-24H,5H2,1-4H3/t13-/m0/s1 |
| InChIKey | MWBAHRRFJNAKHK-ZDUSSCGKSA-N |
| XLogP | 3.84 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|