About (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol
(5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol (PubChem CID 135430560) has the molecular formula C20H22N2O4
and a molecular weight of 354.41 g/mol. Its IUPAC name is (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol.
Molecular Properties
| Compound Name | (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol |
| PubChem CID | 135430560 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol |
| SMILES | CC[C@H]1C(C)=NN=C(c2ccc(OC)c(O)c2)c2cc(OC)c(O)cc21 |
| InChI | InChI=1S/C20H22N2O4/c1-5-13-11(2)21-22-20(12-6-7-18(25-3)16(23)8-12)15-10-19(26-4)17(24)9-14(13)15/h6-10,13,23-24H,5H2,1-4H3/t13-/m0/s1 |
| InChIKey | MWBAHRRFJNAKHK-ZDUSSCGKSA-N |
| XLogP | 3.84 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol?
The IUPAC name of (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol (CID 135430560) is (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol.
What is the SMILES notation for (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol?
The canonical SMILES for (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol is CC[C@H]1C(C)=NN=C(c2ccc(OC)c(O)c2)c2cc(OC)c(O)cc21.
What is the InChIKey of (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol?
The InChIKey is MWBAHRRFJNAKHK-ZDUSSCGKSA-N. The full InChI is InChI=1S/C20H22N2O4/c1-5-13-11(2)21-22-20(12-6-7-18(25-3)16(23)8-12)15-10-19(26-4)17(24)9-14(13)15/h6-10,13,23-24H,5H2,1-4H3/t13-/m0/s1.
What are the key properties of (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol?
(5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol has a molecular weight of 354.41 g/mol, XLogP of 3.84, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-ethyl-1-(3-hydroxy-4-methoxyphenyl)-8-methoxy-4-methyl-5H-2,3-benzodiazepin-7-ol is sourced from PubChem (CID 135430560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).