About 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane
1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane (PubChem CID 142904993) has the molecular formula C23H30N2O3
and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane |
| PubChem CID | 142904993 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane |
| SMILES | CC.CCC1C(C)=NN=C(c2ccc(OC)c(OC)c2)c2ccc(OC)cc21 |
| InChI | InChI=1S/C21H24N2O3.C2H6/c1-6-16-13(2)22-23-21(17-9-8-15(24-3)12-18(16)17)14-7-10-19(25-4)20(11-14)26-5;1-2/h7-12,16H,6H2,1-5H3;1-2H3 |
| InChIKey | FWVBIMZHGFEPMH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane?
The IUPAC name of 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane (CID 142904993) is 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane.
What is the SMILES notation for 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane?
The canonical SMILES for 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane is CC.CCC1C(C)=NN=C(c2ccc(OC)c(OC)c2)c2ccc(OC)cc21.
What is the InChIKey of 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane?
The InChIKey is FWVBIMZHGFEPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O3.C2H6/c1-6-16-13(2)22-23-21(17-9-8-15(24-3)12-18(16)17)14-7-10-19(25-4)20(11-14)26-5;1-2/h7-12,16H,6H2,1-5H3;1-2H3.
What are the key properties of 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane?
1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane has a molecular weight of 382.50 g/mol, XLogP of 5.46, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxyphenyl)-5-ethyl-7-methoxy-4-methyl-5H-2,3-benzodiazepine;ethane is sourced from PubChem (CID 142904993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).