C23H26N2O5 — CID 135508097
1-[(5S)-1-(3,4-diethoxyphenyl)-5-ethyl-7,8-dihydroxy-5H-2,3-benzodiazepin-4-yl]ethanone (PubChem CID 135508097) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 1-[(5S)-1-(3,4-diethoxyphenyl)-5-ethyl-7,8-dihydroxy-5H-2,3-benzodiazepin-4-yl]ethanone.
| Compound Name | 1-[(5S)-1-(3,4-diethoxyphenyl)-5-ethyl-7,8-dihydroxy-5H-2,3-benzodiazepin-4-yl]ethanone |
|---|---|
| PubChem CID | 135508097 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[(5S)-1-(3,4-diethoxyphenyl)-5-ethyl-7,8-dihydroxy-5H-2,3-benzodiazepin-4-yl]ethanone |
| SMILES | CCOc1ccc(C2=NN=C(C(C)=O)[C@@H](CC)c3cc(O)c(O)cc32)cc1OCC |
| InChI | InChI=1S/C23H26N2O5/c1-5-15-16-11-18(27)19(28)12-17(16)23(25-24-22(15)13(4)26)14-8-9-20(29-6-2)21(10-14)30-7-3/h8-12,15,27-28H,5-7H2,1-4H3/t15-/m0/s1 |
| InChIKey | NJRWLHRQJWAKMA-HNNXBMFYSA-N |
| XLogP | 4.18 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|