C10H9ClN4OS — CID 135434134
2,4-diamino-5-(4-chlorophenyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 135434134) has the molecular formula C10H9ClN4OS and a molecular weight of 268.73 g/mol. Its IUPAC name is 2,4-diamino-5-(4-chlorophenyl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-(4-chlorophenyl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135434134 |
| Molecular Formula | C10H9ClN4OS |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2,4-diamino-5-(4-chlorophenyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1nc(N)c(Sc2ccc(Cl)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H9ClN4OS/c11-5-1-3-6(4-2-5)17-7-8(12)14-10(13)15-9(7)16/h1-4H,(H5,12,13,14,15,16) |
| InChIKey | HTPWHBIVHVHWSF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |