C10H8Cl2N4OS — CID 135434141
2,4-diamino-5-(2,6-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 135434141) has the molecular formula C10H8Cl2N4OS and a molecular weight of 303.17 g/mol. Its IUPAC name is 2,4-diamino-5-(2,6-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-(2,6-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135434141 |
| Molecular Formula | C10H8Cl2N4OS |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 2,4-diamino-5-(2,6-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1nc(N)c(Sc2c(Cl)cccc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C10H8Cl2N4OS/c11-4-2-1-3-5(12)6(4)18-7-8(13)15-10(14)16-9(7)17/h1-3H,(H5,13,14,15,16,17) |
| InChIKey | JBFZICSUTGONJB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |