C19H15N3O8 — CID 135434303
5-hydroxy-2-[3-[(2-methoxy-5-nitrophenyl)methoxy]phenyl]-6-oxo-1H-pyrimidine-4-carboxylic acid (PubChem CID 135434303) has the molecular formula C19H15N3O8 and a molecular weight of 413.34 g/mol. Its IUPAC name is 5-hydroxy-2-[3-[(2-methoxy-5-nitrophenyl)methoxy]phenyl]-6-oxo-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 5-hydroxy-2-[3-[(2-methoxy-5-nitrophenyl)methoxy]phenyl]-6-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135434303 |
| Molecular Formula | C19H15N3O8 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 5-hydroxy-2-[3-[(2-methoxy-5-nitrophenyl)methoxy]phenyl]-6-oxo-1H-pyrimidine-4-carboxylic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1COc1cccc(-c2nc(C(=O)O)c(O)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C19H15N3O8/c1-29-14-6-5-12(22(27)28)7-11(14)9-30-13-4-2-3-10(8-13)17-20-15(19(25)26)16(23)18(24)21-17/h2-8,23H,9H2,1H3,(H,25,26)(H,20,21,24) |
| InChIKey | IVTWTWSUTGVPIO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 164.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|