C35H27N3O4 — CID 4921922
2-(3-methoxy-4-phenylmethoxyphenyl)-5-[4-(4-nitrophenyl)phenyl]-4-phenyl-1H-imidazole (PubChem CID 4921922) has the molecular formula C35H27N3O4 and a molecular weight of 553.62 g/mol. Its IUPAC name is 2-(3-methoxy-4-phenylmethoxyphenyl)-5-[4-(4-nitrophenyl)phenyl]-4-phenyl-1H-imidazole.
| Compound Name | 2-(3-methoxy-4-phenylmethoxyphenyl)-5-[4-(4-nitrophenyl)phenyl]-4-phenyl-1H-imidazole |
|---|---|
| PubChem CID | 4921922 |
| Molecular Formula | C35H27N3O4 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 2-(3-methoxy-4-phenylmethoxyphenyl)-5-[4-(4-nitrophenyl)phenyl]-4-phenyl-1H-imidazole |
| SMILES | COc1cc(-c2nc(-c3ccccc3)c(-c3ccc(-c4ccc([N+](=O)[O-])cc4)cc3)[nH]2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H27N3O4/c1-41-32-22-29(18-21-31(32)42-23-24-8-4-2-5-9-24)35-36-33(27-10-6-3-7-11-27)34(37-35)28-14-12-25(13-15-28)26-16-19-30(20-17-26)38(39)40/h2-22H,23H2,1H3,(H,36,37) |
| InChIKey | LJUYEUOVWSLYEV-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|