C10H18N5O12P3 — CID 135434853
[[(2S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)butoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 135434853) has the molecular formula C10H18N5O12P3 and a molecular weight of 493.20 g/mol. Its IUPAC name is [[(2S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)butoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)butoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 135434853 |
| Molecular Formula | C10H18N5O12P3 |
| Molecular Weight | 493.20 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | [[(2S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)butoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2CC[C@@H](CO)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H18N5O12P3/c11-10-13-8-7(9(17)14-10)12-5-15(8)2-1-6(3-16)4-25-29(21,22)27-30(23,24)26-28(18,19)20/h5-6,16H,1-4H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,13,14,17)/t6-/m0/s1 |
| InChIKey | KGSIOVLUJYQLKR-LURJTMIESA-N |
| XLogP | -0.96 |
| TPSA | 269.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.20 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|