C15H13FN4O3S — CID 135435019
4-[[5-(3-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]benzenesulfonamide (PubChem CID 135435019) has the molecular formula C15H13FN4O3S and a molecular weight of 348.36 g/mol. Its IUPAC name is 4-[[5-(3-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[5-(3-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 135435019 |
| Molecular Formula | C15H13FN4O3S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-[[5-(3-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2cc(-c3ccc(O)c(F)c3)[nH]n2)cc1 |
| InChI | InChI=1S/C15H13FN4O3S/c16-12-7-9(1-6-14(12)21)13-8-15(20-19-13)18-10-2-4-11(5-3-10)24(17,22)23/h1-8,21H,(H2,17,22,23)(H2,18,19,20) |
| InChIKey | QVUJFGWIMPTAEH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |