C16H14FN3O2 — CID 139391695
2-fluoro-4-[[5-(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]-5-methylphenol (PubChem CID 139391695) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-fluoro-4-[[5-(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]-5-methylphenol.
| Compound Name | 2-fluoro-4-[[5-(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]-5-methylphenol |
|---|---|
| PubChem CID | 139391695 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-fluoro-4-[[5-(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]-5-methylphenol |
| SMILES | Cc1cc(O)c(F)cc1Nc1cc(-c2ccc(O)cc2)[nH]n1 |
| InChI | InChI=1S/C16H14FN3O2/c1-9-6-15(22)12(17)7-13(9)18-16-8-14(19-20-16)10-2-4-11(21)5-3-10/h2-8,21-22H,1H3,(H2,18,19,20) |
| InChIKey | AKWKXDHRODVHCB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|