C17H15FN4O3 — CID 139392003
[4-[[5-(3-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]-3-methylphenyl]carbamic acid (PubChem CID 139392003) has the molecular formula C17H15FN4O3 and a molecular weight of 342.33 g/mol. Its IUPAC name is [4-[[5-(3-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]-3-methylphenyl]carbamic acid.
| Compound Name | [4-[[5-(3-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]-3-methylphenyl]carbamic acid |
|---|---|
| PubChem CID | 139392003 |
| Molecular Formula | C17H15FN4O3 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | [4-[[5-(3-fluoro-4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]-3-methylphenyl]carbamic acid |
| SMILES | Cc1cc(NC(=O)O)ccc1Nc1cc(-c2ccc(O)c(F)c2)[nH]n1 |
| InChI | InChI=1S/C17H15FN4O3/c1-9-6-11(19-17(24)25)3-4-13(9)20-16-8-14(21-22-16)10-2-5-15(23)12(18)7-10/h2-8,19,23H,1H3,(H,24,25)(H2,20,21,22) |
| InChIKey | SDFQMEBMCQRBIT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |