C16H12MnN4O3S2 — CID 135437177
N-benzoyl-N'-[(2-hydroxybenzoyl)amino]carbamimidothioate;manganese(2+);thiocyanate (PubChem CID 135437177) has the molecular formula C16H12MnN4O3S2 and a molecular weight of 427.37 g/mol. Its IUPAC name is N-benzoyl-N'-[(2-hydroxybenzoyl)amino]carbamimidothioate;manganese(2+);thiocyanate.
| Compound Name | N-benzoyl-N'-[(2-hydroxybenzoyl)amino]carbamimidothioate;manganese(2+);thiocyanate |
|---|---|
| PubChem CID | 135437177 |
| Molecular Formula | C16H12MnN4O3S2 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | N-benzoyl-N'-[(2-hydroxybenzoyl)amino]carbamimidothioate;manganese(2+);thiocyanate |
| SMILES | N#C[S-].O=C(N/C([S-])=N/NC(=O)c1ccccc1O)c1ccccc1.[Mn+2] |
| InChI | InChI=1S/C15H13N3O3S.CHNS.Mn/c19-12-9-5-4-8-11(12)14(21)17-18-15(22)16-13(20)10-6-2-1-3-7-10;2-1-3;/h1-9,19H,(H,17,21)(H2,16,18,20,22);3H;/q;;+2/p-2 |
| InChIKey | ADKMQNLERXTEBR-UHFFFAOYSA-L |
| XLogP | 1.38 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|