C22H26ClN7O4S2 — CID 135441296
6-chloro-3-[[5-[[(1R)-2,2-dimethyl-1-(5-methylthiophen-2-yl)propyl]amino]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide (PubChem CID 135441296) has the molecular formula C22H26ClN7O4S2 and a molecular weight of 552.08 g/mol. Its IUPAC name is 6-chloro-3-[[5-[[(1R)-2,2-dimethyl-1-(5-methylthiophen-2-yl)propyl]amino]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 6-chloro-3-[[5-[[(1R)-2,2-dimethyl-1-(5-methylthiophen-2-yl)propyl]amino]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135441296 |
| Molecular Formula | C22H26ClN7O4S2 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 6-chloro-3-[[5-[[(1R)-2,2-dimethyl-1-(5-methylthiophen-2-yl)propyl]amino]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc([C@H](Nc2nc3nonc3nc2Nc2ccc(Cl)c(S(=O)(=O)N(C)C)c2O)C(C)(C)C)s1 |
| InChI | InChI=1S/C22H26ClN7O4S2/c1-11-7-10-14(35-11)17(22(2,3)4)25-19-18(26-20-21(27-19)29-34-28-20)24-13-9-8-12(23)16(15(13)31)36(32,33)30(5)6/h7-10,17,31H,1-6H3,(H,24,26,28)(H,25,27,29)/t17-/m0/s1 |
| InChIKey | YLVDRZKVOGYMSV-KRWDZBQOSA-N |
| XLogP | 4.93 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|