C21H26ClN5O4S2 — CID 173479186
6-chloro-3-[[4-[(1R)-2,2-dimethyl-1-phenylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide (PubChem CID 173479186) has the molecular formula C21H26ClN5O4S2 and a molecular weight of 512.06 g/mol. Its IUPAC name is 6-chloro-3-[[4-[(1R)-2,2-dimethyl-1-phenylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 6-chloro-3-[[4-[(1R)-2,2-dimethyl-1-phenylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 173479186 |
| Molecular Formula | C21H26ClN5O4S2 |
| Molecular Weight | 512.06 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 6-chloro-3-[[4-[(1R)-2,2-dimethyl-1-phenylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(Cl)ccc(Nc2n[s+]([O-])[nH]/c2=N\[C@@H](c2ccccc2)C(C)(C)C)c1O |
| InChI | InChI=1S/C21H26ClN5O4S2/c1-21(2,3)18(13-9-7-6-8-10-13)24-20-19(25-32(29)26-20)23-15-12-11-14(22)17(16(15)28)33(30,31)27(4)5/h6-12,18,28H,1-5H3,(H,23,25)(H,24,26)/t18-,32?/m0/s1 |
| InChIKey | OXPVRBNRORSJHZ-DVYMHAMMSA-N |
| XLogP | 4.18 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.06 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|