C22H27N5O2S — CID 173479441
3-[[4-(2,2-dimethyl-1-phenylpropyl)imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-N,N-dimethylbenzamide (PubChem CID 173479441) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 3-[[4-(2,2-dimethyl-1-phenylpropyl)imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[4-(2,2-dimethyl-1-phenylpropyl)imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 173479441 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-[[4-(2,2-dimethyl-1-phenylpropyl)imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(Nc2n[s+]([O-])[nH]/c2=N\C(c2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H27N5O2S/c1-22(2,3)18(15-10-7-6-8-11-15)24-20-19(25-30(29)26-20)23-17-13-9-12-16(14-17)21(28)27(4)5/h6-14,18H,1-5H3,(H,23,25)(H,24,26) |
| InChIKey | DVGDAUVOWDQYTM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|