C19H24ClN5O5S2 — CID 173478827
3-[[4-[(1R)-1-(5-chlorofuran-2-yl)-2,2-dimethylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide (PubChem CID 173478827) has the molecular formula C19H24ClN5O5S2 and a molecular weight of 502.02 g/mol. Its IUPAC name is 3-[[4-[(1R)-1-(5-chlorofuran-2-yl)-2,2-dimethylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[4-[(1R)-1-(5-chlorofuran-2-yl)-2,2-dimethylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 173478827 |
| Molecular Formula | C19H24ClN5O5S2 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 3-[[4-[(1R)-1-(5-chlorofuran-2-yl)-2,2-dimethylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(Nc2n[s+]([O-])[nH]/c2=N\[C@@H](c2ccc(Cl)o2)C(C)(C)C)c1O |
| InChI | InChI=1S/C19H24ClN5O5S2/c1-19(2,3)16(12-9-10-14(20)30-12)22-18-17(23-31(27)24-18)21-11-7-6-8-13(15(11)26)32(28,29)25(4)5/h6-10,16,26H,1-5H3,(H,21,23)(H,22,24)/t16-,31?/m0/s1 |
| InChIKey | XFFBEIOZNUSLOD-YDIHDLSKSA-N |
| XLogP | 3.77 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|