C18H21N5O4S — CID 173479164
2-hydroxy-N-methyl-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzamide (PubChem CID 173479164) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-hydroxy-N-methyl-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzamide.
| Compound Name | 2-hydroxy-N-methyl-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 173479164 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-hydroxy-N-methyl-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzamide |
| SMILES | CC[C@@H](/N=c1\[nH][s+]([O-])nc1Nc1cccc(C(=O)NC)c1O)c1ccc(C)o1 |
| InChI | InChI=1S/C18H21N5O4S/c1-4-12(14-9-8-10(2)27-14)20-16-17(23-28(26)22-16)21-13-7-5-6-11(15(13)24)18(25)19-3/h5-9,12,24H,4H2,1-3H3,(H,19,25)(H,20,22)(H,21,23)/t12-,28?/m1/s1 |
| InChIKey | LVERHPRQZIIYIB-RKWVHCRBSA-N |
| XLogP | 2.90 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|