C21H22F3N5O3S — CID 173478784
2-hydroxy-N,N-dimethyl-3-[[1-oxido-4-[(1R)-1-phenylpropyl]imino-1,2,5-thiadiazol-1-ium-3-yl]amino]-6-(trifluoromethyl)benzamide (PubChem CID 173478784) has the molecular formula C21H22F3N5O3S and a molecular weight of 481.50 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3-[[1-oxido-4-[(1R)-1-phenylpropyl]imino-1,2,5-thiadiazol-1-ium-3-yl]amino]-6-(trifluoromethyl)benzamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-3-[[1-oxido-4-[(1R)-1-phenylpropyl]imino-1,2,5-thiadiazol-1-ium-3-yl]amino]-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 173478784 |
| Molecular Formula | C21H22F3N5O3S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3-[[1-oxido-4-[(1R)-1-phenylpropyl]imino-1,2,5-thiadiazol-1-ium-3-yl]amino]-6-(trifluoromethyl)benzamide |
| SMILES | CC[C@@H](/N=c1\[nH][s+]([O-])nc1Nc1ccc(C(F)(F)F)c(C(=O)N(C)C)c1O)c1ccccc1 |
| InChI | InChI=1S/C21H22F3N5O3S/c1-4-14(12-8-6-5-7-9-12)25-18-19(28-33(32)27-18)26-15-11-10-13(21(22,23)24)16(17(15)30)20(31)29(2)3/h5-11,14,30H,4H2,1-3H3,(H,25,27)(H,26,28)/t14-,33?/m1/s1 |
| InChIKey | CRARPOXVLNEOJR-PXYRPBPISA-N |
| XLogP | 4.36 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|