C15H21N5O3S — CID 173488858
3-[(4-butan-2-ylimino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 173488858) has the molecular formula C15H21N5O3S and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-[(4-butan-2-ylimino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[(4-butan-2-ylimino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 173488858 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-[(4-butan-2-ylimino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CCC(C)/N=c1\[nH][s+]([O-])nc1Nc1cccc(C(=O)N(C)C)c1O |
| InChI | InChI=1S/C15H21N5O3S/c1-5-9(2)16-13-14(19-24(23)18-13)17-11-8-6-7-10(12(11)21)15(22)20(3)4/h6-9,21H,5H2,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | LLATUEALGCTEMS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|