C27H33N7O4S — CID 173488730
[4-[(1E,3Z)-1-aminohexa-1,3,5-trienyl]piperazin-1-yl]-[2-hydroxy-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]phenyl]methanone (PubChem CID 173488730) has the molecular formula C27H33N7O4S and a molecular weight of 551.67 g/mol. Its IUPAC name is [4-[(1E,3Z)-1-aminohexa-1,3,5-trienyl]piperazin-1-yl]-[2-hydroxy-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]phenyl]methanone.
| Compound Name | [4-[(1E,3Z)-1-aminohexa-1,3,5-trienyl]piperazin-1-yl]-[2-hydroxy-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]phenyl]methanone |
|---|---|
| PubChem CID | 173488730 |
| Molecular Formula | C27H33N7O4S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | [4-[(1E,3Z)-1-aminohexa-1,3,5-trienyl]piperazin-1-yl]-[2-hydroxy-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]phenyl]methanone |
| SMILES | C=C/C=C\C=C(/N)N1CCN(C(=O)c2cccc(Nc3n[s+]([O-])[nH]/c3=N\[C@H](CC)c3ccc(C)o3)c2O)CC1 |
| InChI | InChI=1S/C27H33N7O4S/c1-4-6-7-11-23(28)33-14-16-34(17-15-33)27(36)19-9-8-10-21(24(19)35)30-26-25(31-39(37)32-26)29-20(5-2)22-13-12-18(3)38-22/h4,6-13,20,35H,1,5,14-17,28H2,2-3H3,(H,29,31)(H,30,32)/b7-6-,23-11+/t20-,39?/m1/s1 |
| InChIKey | WBTCLUTYGVXFOT-GQUQUQPESA-N |
| XLogP | 3.84 |
| TPSA | 159.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|