C21H23N5O5S2 — CID 173479430
2-[[2-hydroxy-3-[[4-[2-methyl-1-(5-methylthiophen-2-yl)prop-2-enyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzoyl]-methylamino]acetic acid (PubChem CID 173479430) has the molecular formula C21H23N5O5S2 and a molecular weight of 489.58 g/mol. Its IUPAC name is 2-[[2-hydroxy-3-[[4-[2-methyl-1-(5-methylthiophen-2-yl)prop-2-enyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzoyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-hydroxy-3-[[4-[2-methyl-1-(5-methylthiophen-2-yl)prop-2-enyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 173479430 |
| Molecular Formula | C21H23N5O5S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-[[2-hydroxy-3-[[4-[2-methyl-1-(5-methylthiophen-2-yl)prop-2-enyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzoyl]-methylamino]acetic acid |
| SMILES | C=C(C)C(/N=c1\[nH][s+]([O-])nc1Nc1cccc(C(=O)N(C)CC(=O)O)c1O)c1ccc(C)s1 |
| InChI | InChI=1S/C21H23N5O5S2/c1-11(2)17(15-9-8-12(3)32-15)23-20-19(24-33(31)25-20)22-14-7-5-6-13(18(14)29)21(30)26(4)10-16(27)28/h5-9,17,29H,1,10H2,2-4H3,(H,22,24)(H,23,25)(H,27,28) |
| InChIKey | FPECAGLECXGUBP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|