C12H17N5O4S2 — CID 173490694
3-[(4-ethylimino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl)amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide (PubChem CID 173490694) has the molecular formula C12H17N5O4S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-[(4-ethylimino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl)amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[(4-ethylimino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl)amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 173490694 |
| Molecular Formula | C12H17N5O4S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-[(4-ethylimino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl)amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CC/N=c1\[nH][s+]([O-])nc1Nc1cccc(S(=O)(=O)N(C)C)c1O |
| InChI | InChI=1S/C12H17N5O4S2/c1-4-13-11-12(16-22(19)15-11)14-8-6-5-7-9(10(8)18)23(20,21)17(2)3/h5-7,18H,4H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | QTVVGFVBRWKTOW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|