C21H27N5O5S2 — CID 135430396
3-[[4-[(1R)-2,2-dimethyl-1-phenylpropyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide (PubChem CID 135430396) has the molecular formula C21H27N5O5S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 3-[[4-[(1R)-2,2-dimethyl-1-phenylpropyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[4-[(1R)-2,2-dimethyl-1-phenylpropyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135430396 |
| Molecular Formula | C21H27N5O5S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 3-[[4-[(1R)-2,2-dimethyl-1-phenylpropyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC2=NS(=O)(=O)N/C2=N\[C@@H](c2ccccc2)C(C)(C)C)c1O |
| InChI | InChI=1S/C21H27N5O5S2/c1-21(2,3)18(14-10-7-6-8-11-14)23-20-19(24-33(30,31)25-20)22-15-12-9-13-16(17(15)27)32(28,29)26(4)5/h6-13,18,27H,1-5H3,(H,22,24)(H,23,25)/t18-/m0/s1 |
| InChIKey | TYXKRJMUXPJIHL-SFHVURJKSA-N |
| XLogP | 2.49 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|