C21H27BrN5O5S+ — CID 158497080
6-bromo-3-[[4-[(1R)-2,2-dimethyl-1-(4-methylfuran-1-ium-2-yl)propyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 158497080) has the molecular formula C21H27BrN5O5S+ and a molecular weight of 541.45 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(1R)-2,2-dimethyl-1-(4-methylfuran-1-ium-2-yl)propyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 6-bromo-3-[[4-[(1R)-2,2-dimethyl-1-(4-methylfuran-1-ium-2-yl)propyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 158497080 |
| Molecular Formula | C21H27BrN5O5S+ |
| Molecular Weight | 541.45 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 6-bromo-3-[[4-[(1R)-2,2-dimethyl-1-(4-methylfuran-1-ium-2-yl)propyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | Cc1c[oH+]c([C@H](/N=C2\NS(=O)(=O)N=C2Nc2ccc(Br)c(C(=O)N(C)C)c2O)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H26BrN5O5S/c1-11-9-14(32-10-11)17(21(2,3)4)24-19-18(25-33(30,31)26-19)23-13-8-7-12(22)15(16(13)28)20(29)27(5)6/h7-10,17,28H,1-6H3,(H,23,25)(H,24,26)/p+1/t17-/m0/s1 |
| InChIKey | HJKSLTUIPQYBJT-KRWDZBQOSA-O |
| XLogP | 3.71 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|