C22H30N6O3Si — CID 136594830
CID 136594830 (PubChem CID 136594830) has the molecular formula C22H30N6O3Si and a molecular weight of 454.61 g/mol.
| Compound Name | CID 136594830 |
|---|---|
| PubChem CID | 136594830 |
| Molecular Formula | C22H30N6O3Si |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | — |
| SMILES | Cc1cc([C@@H](C(C)C)N(N)C2=N[Si]N=C2Nc2ccc(C)c(C(=O)N(C)C)c2O)oc1C |
| InChI | InChI=1S/C22H30N6O3Si/c1-11(2)18(16-10-13(4)14(5)31-16)28(23)21-20(25-32-26-21)24-15-9-8-12(3)17(19(15)29)22(30)27(6)7/h8-11,18,29H,23H2,1-7H3,(H,24,25)/t18-/m1/s1 |
| InChIKey | LNYVYGQOCSDTKM-GOSISDBHSA-N |
| XLogP | 2.94 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|