C25H37N5O3 — CID 143076550
6-tert-butyl-3-[[1,2-diamino-2-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]iminoethylidene]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 143076550) has the molecular formula C25H37N5O3 and a molecular weight of 455.60 g/mol. Its IUPAC name is 6-tert-butyl-3-[[1,2-diamino-2-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]iminoethylidene]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 6-tert-butyl-3-[[1,2-diamino-2-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]iminoethylidene]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 143076550 |
| Molecular Formula | C25H37N5O3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 6-tert-butyl-3-[[1,2-diamino-2-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]iminoethylidene]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | Cc1cc([C@H](/N=C(N)/C(N)=N/c2ccc(C(C)(C)C)c(C(=O)N(C)C)c2O)C(C)C)oc1C |
| InChI | InChI=1S/C25H37N5O3/c1-13(2)20(18-12-14(3)15(4)33-18)29-23(27)22(26)28-17-11-10-16(25(5,6)7)19(21(17)31)24(32)30(8)9/h10-13,20,31H,1-9H3,(H2,26,28)(H2,27,29)/t20-/m1/s1 |
| InChIKey | WNVBUVNXPLRLFC-HXUWFJFHSA-N |
| XLogP | 4.34 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|