C21H25F3N4O5S — CID 147335893
(E)-3-amino-2-[3-(dimethylcarbamoyl)-2-hydroxy-4-(trifluoromethyl)anilino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]iminoprop-1-ene-1-sulfinic acid (PubChem CID 147335893) has the molecular formula C21H25F3N4O5S and a molecular weight of 502.52 g/mol. Its IUPAC name is (E)-3-amino-2-[3-(dimethylcarbamoyl)-2-hydroxy-4-(trifluoromethyl)anilino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]iminoprop-1-ene-1-sulfinic acid.
| Compound Name | (E)-3-amino-2-[3-(dimethylcarbamoyl)-2-hydroxy-4-(trifluoromethyl)anilino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]iminoprop-1-ene-1-sulfinic acid |
|---|---|
| PubChem CID | 147335893 |
| Molecular Formula | C21H25F3N4O5S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | (E)-3-amino-2-[3-(dimethylcarbamoyl)-2-hydroxy-4-(trifluoromethyl)anilino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]iminoprop-1-ene-1-sulfinic acid |
| SMILES | CC[C@@H](/N=C(N)/C(=C\S(=O)O)Nc1ccc(C(F)(F)F)c(C(=O)N(C)C)c1O)c1ccc(C)o1 |
| InChI | InChI=1S/C21H25F3N4O5S/c1-5-13(16-9-6-11(2)33-16)27-19(25)15(10-34(31)32)26-14-8-7-12(21(22,23)24)17(18(14)29)20(30)28(3)4/h6-10,13,26,29H,5H2,1-4H3,(H2,25,27)(H,31,32)/b15-10+/t13-/m1/s1 |
| InChIKey | DCOAAUXIPWDWAS-QQFZQELXSA-N |
| XLogP | 4.00 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|