C14H13F3N4O6S — CID 58597669
4-[3-(dimethylcarbamoyl)-2-hydroxy-4-(trifluoromethyl)anilino]-1,1,3-trioxo-1,2-thiazole-5-carboxamide (PubChem CID 58597669) has the molecular formula C14H13F3N4O6S and a molecular weight of 422.34 g/mol. Its IUPAC name is 4-[3-(dimethylcarbamoyl)-2-hydroxy-4-(trifluoromethyl)anilino]-1,1,3-trioxo-1,2-thiazole-5-carboxamide.
| Compound Name | 4-[3-(dimethylcarbamoyl)-2-hydroxy-4-(trifluoromethyl)anilino]-1,1,3-trioxo-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 58597669 |
| Molecular Formula | C14H13F3N4O6S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 4-[3-(dimethylcarbamoyl)-2-hydroxy-4-(trifluoromethyl)anilino]-1,1,3-trioxo-1,2-thiazole-5-carboxamide |
| SMILES | CN(C)C(=O)c1c(C(F)(F)F)ccc(NC2=C(C(N)=O)S(=O)(=O)NC2=O)c1O |
| InChI | InChI=1S/C14H13F3N4O6S/c1-21(2)13(25)7-5(14(15,16)17)3-4-6(9(7)22)19-8-10(11(18)23)28(26,27)20-12(8)24/h3-4,19,22H,1-2H3,(H2,18,23)(H,20,24) |
| InChIKey | NZBWTKHUMVNUNL-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|