C24H29N3O5 — CID 58418486
3-[[2-[[2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N,6-trimethylbenzamide (PubChem CID 58418486) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is 3-[[2-[[2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N,6-trimethylbenzamide.
| Compound Name | 3-[[2-[[2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N,6-trimethylbenzamide |
|---|---|
| PubChem CID | 58418486 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-[[2-[[2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N,6-trimethylbenzamide |
| SMILES | Cc1ccc(C(Nc2c(Nc3ccc(C)c(C(=O)N(C)C)c3O)c(=O)c2=O)C(C)(C)C)o1 |
| InChI | InChI=1S/C24H29N3O5/c1-12-8-10-14(19(28)16(12)23(31)27(6)7)25-17-18(21(30)20(17)29)26-22(24(3,4)5)15-11-9-13(2)32-15/h8-11,22,25-26,28H,1-7H3 |
| InChIKey | XKFWYQSZJRVWBF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|