C19H23IN5O5S- — CID 147993736
3-[[4-[(R)-(4,5-dimethylfuran-2-yl)-methyliodanuidylmethyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 147993736) has the molecular formula C19H23IN5O5S- and a molecular weight of 560.39 g/mol. Its IUPAC name is 3-[[4-[(R)-(4,5-dimethylfuran-2-yl)-methyliodanuidylmethyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[4-[(R)-(4,5-dimethylfuran-2-yl)-methyliodanuidylmethyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 147993736 |
| Molecular Formula | C19H23IN5O5S- |
| Molecular Weight | 560.39 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | 3-[[4-[(R)-(4,5-dimethylfuran-2-yl)-methyliodanuidylmethyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | C[I-][C@@H](N=C1NS(=O)(=O)N=C1Nc1cccc(C(=O)N(C)C)c1O)c1cc(C)c(C)o1 |
| InChI | InChI=1S/C19H23IN5O5S/c1-10-9-14(30-11(10)2)16(20-3)22-18-17(23-31(28,29)24-18)21-13-8-6-7-12(15(13)26)19(27)25(4)5/h6-9,16,26H,1-5H3,(H,21,23)(H,22,24)/q-1/t16-/m0/s1 |
| InChIKey | RHAILXCGLRGQRG-INIZCTEOSA-N |
| XLogP | -1.22 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.39 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|