C23H25N5O5S — CID 142883449
3-[[4-[(1R)-1-(3a,7a-dihydro-1-benzofuran-2-yl)-2-methylprop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 142883449) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is 3-[[4-[(1R)-1-(3a,7a-dihydro-1-benzofuran-2-yl)-2-methylprop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[4-[(1R)-1-(3a,7a-dihydro-1-benzofuran-2-yl)-2-methylprop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 142883449 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-[[4-[(1R)-1-(3a,7a-dihydro-1-benzofuran-2-yl)-2-methylprop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | C=C(C)[C@@H](/N=C1\NS(=O)(=O)N=C1Nc1cccc(C(=O)N(C)C)c1O)C1=CC2C=CC=CC2O1 |
| InChI | InChI=1S/C23H25N5O5S/c1-13(2)19(18-12-14-8-5-6-11-17(14)33-18)25-22-21(26-34(31,32)27-22)24-16-10-7-9-15(20(16)29)23(30)28(3)4/h5-12,14,17,19,29H,1H2,2-4H3,(H,24,26)(H,25,27)/t14?,17?,19-/m1/s1 |
| InChIKey | QMRAKSXKLWFERK-ITXXBFQVSA-N |
| XLogP | 2.12 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|