C20H21N5O4S — CID 142883611
2-hydroxy-3-[[4-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)prop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzonitrile (PubChem CID 142883611) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is 2-hydroxy-3-[[4-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)prop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzonitrile.
| Compound Name | 2-hydroxy-3-[[4-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)prop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 142883611 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-hydroxy-3-[[4-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)prop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzonitrile |
| SMILES | C=C(C)[C@@H](/N=C1\NS(=O)(=O)N=C1Nc1cccc(C#N)c1O)c1cc(C(C)C)co1 |
| InChI | InChI=1S/C20H21N5O4S/c1-11(2)14-8-16(29-10-14)17(12(3)4)23-20-19(24-30(27,28)25-20)22-15-7-5-6-13(9-21)18(15)26/h5-8,10-11,17,26H,3H2,1-2,4H3,(H,22,24)(H,23,25)/t17-/m1/s1 |
| InChIKey | PYPPOXXQNMKWEK-QGZVFWFLSA-N |
| XLogP | 3.35 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|