C21H21N5O4S — CID 173490675
3-[[4-[1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxybenzonitrile (PubChem CID 173490675) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is 3-[[4-[1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxybenzonitrile.
| Compound Name | 3-[[4-[1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 173490675 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 3-[[4-[1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxybenzonitrile |
| SMILES | CC(C)(C)C(/N=c1\[nH][s+]([O-])nc1Nc1cccc(C#N)c1O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21N5O4S/c1-21(2,3)18(12-7-8-15-16(9-12)30-11-29-15)24-20-19(25-31(28)26-20)23-14-6-4-5-13(10-22)17(14)27/h4-9,18,27H,11H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | OMILQEUFVPYFML-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|