C17H19N5O5S — CID 142883388
2-hydroxy-N,N-dimethyl-3-[[4-[(5-methylfuran-2-yl)methylimino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzamide (PubChem CID 142883388) has the molecular formula C17H19N5O5S and a molecular weight of 405.44 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3-[[4-[(5-methylfuran-2-yl)methylimino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-3-[[4-[(5-methylfuran-2-yl)methylimino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 142883388 |
| Molecular Formula | C17H19N5O5S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3-[[4-[(5-methylfuran-2-yl)methylimino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzamide |
| SMILES | Cc1ccc(C/N=C2\NS(=O)(=O)N=C2Nc2cccc(C(=O)N(C)C)c2O)o1 |
| InChI | InChI=1S/C17H19N5O5S/c1-10-7-8-11(27-10)9-18-15-16(21-28(25,26)20-15)19-13-6-4-5-12(14(13)23)17(24)22(2)3/h4-8,23H,9H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | VPIALGKTIQANNV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|