C18H18ClN5O5S2 — CID 142882973
6-chloro-2-hydroxy-3-[[4-[(1R)-2-methyl-1-phenylprop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzenesulfonamide (PubChem CID 142882973) has the molecular formula C18H18ClN5O5S2 and a molecular weight of 483.96 g/mol. Its IUPAC name is 6-chloro-2-hydroxy-3-[[4-[(1R)-2-methyl-1-phenylprop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzenesulfonamide.
| Compound Name | 6-chloro-2-hydroxy-3-[[4-[(1R)-2-methyl-1-phenylprop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 142882973 |
| Molecular Formula | C18H18ClN5O5S2 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 6-chloro-2-hydroxy-3-[[4-[(1R)-2-methyl-1-phenylprop-2-enyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzenesulfonamide |
| SMILES | C=C(C)[C@@H](/N=C1\NS(=O)(=O)N=C1Nc1ccc(Cl)c(S(N)(=O)=O)c1O)c1ccccc1 |
| InChI | InChI=1S/C18H18ClN5O5S2/c1-10(2)14(11-6-4-3-5-7-11)22-18-17(23-31(28,29)24-18)21-13-9-8-12(19)16(15(13)25)30(20,26)27/h3-9,14,25H,1H2,2H3,(H,21,23)(H,22,24)(H2,20,26,27)/t14-/m1/s1 |
| InChIKey | JNXUZGARWKPBMG-CQSZACIVSA-N |
| XLogP | 2.07 |
| TPSA | 163.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|