C9H12ClN3O4S — CID 87695533
[4-chloro-3-(dimethylsulfamoyl)-2-hydroxyphenyl]urea (PubChem CID 87695533) has the molecular formula C9H12ClN3O4S and a molecular weight of 293.73 g/mol. Its IUPAC name is [4-chloro-3-(dimethylsulfamoyl)-2-hydroxyphenyl]urea.
| Compound Name | [4-chloro-3-(dimethylsulfamoyl)-2-hydroxyphenyl]urea |
|---|---|
| PubChem CID | 87695533 |
| Molecular Formula | C9H12ClN3O4S |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | [4-chloro-3-(dimethylsulfamoyl)-2-hydroxyphenyl]urea |
| SMILES | CN(C)S(=O)(=O)c1c(Cl)ccc(NC(N)=O)c1O |
| InChI | InChI=1S/C9H12ClN3O4S/c1-13(2)18(16,17)8-5(10)3-4-6(7(8)14)12-9(11)15/h3-4,14H,1-2H3,(H3,11,12,15) |
| InChIKey | CZQRQCYIVVDBAL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|