C25H22ClN3O6S — CID 91269755
3-[[2-(benzhydrylamino)-3,4-dioxocyclobuten-1-yl]amino]-6-chloro-2-[hydroxy(methoxy)methyl]benzenesulfonamide (PubChem CID 91269755) has the molecular formula C25H22ClN3O6S and a molecular weight of 527.99 g/mol. Its IUPAC name is 3-[[2-(benzhydrylamino)-3,4-dioxocyclobuten-1-yl]amino]-6-chloro-2-[hydroxy(methoxy)methyl]benzenesulfonamide.
| Compound Name | 3-[[2-(benzhydrylamino)-3,4-dioxocyclobuten-1-yl]amino]-6-chloro-2-[hydroxy(methoxy)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91269755 |
| Molecular Formula | C25H22ClN3O6S |
| Molecular Weight | 527.99 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 3-[[2-(benzhydrylamino)-3,4-dioxocyclobuten-1-yl]amino]-6-chloro-2-[hydroxy(methoxy)methyl]benzenesulfonamide |
| SMILES | COC(O)c1c(Nc2c(NC(c3ccccc3)c3ccccc3)c(=O)c2=O)ccc(Cl)c1S(N)(=O)=O |
| InChI | InChI=1S/C25H22ClN3O6S/c1-35-25(32)18-17(13-12-16(26)24(18)36(27,33)34)28-20-21(23(31)22(20)30)29-19(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-13,19,25,28-29,32H,1H3,(H2,27,33,34) |
| InChIKey | UNVGXFLGGKPNCF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.99 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|