C21H21ClFN3O6S — CID 90740758
6-chloro-3-[[2-[1-(2-fluorophenyl)propan-2-ylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-[hydroxy(methoxy)methyl]benzenesulfonamide (PubChem CID 90740758) has the molecular formula C21H21ClFN3O6S and a molecular weight of 497.93 g/mol. Its IUPAC name is 6-chloro-3-[[2-[1-(2-fluorophenyl)propan-2-ylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-[hydroxy(methoxy)methyl]benzenesulfonamide.
| Compound Name | 6-chloro-3-[[2-[1-(2-fluorophenyl)propan-2-ylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-[hydroxy(methoxy)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90740758 |
| Molecular Formula | C21H21ClFN3O6S |
| Molecular Weight | 497.93 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 6-chloro-3-[[2-[1-(2-fluorophenyl)propan-2-ylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-[hydroxy(methoxy)methyl]benzenesulfonamide |
| SMILES | COC(O)c1c(Nc2c(NC(C)Cc3ccccc3F)c(=O)c2=O)ccc(Cl)c1S(N)(=O)=O |
| InChI | InChI=1S/C21H21ClFN3O6S/c1-10(9-11-5-3-4-6-13(11)23)25-16-17(19(28)18(16)27)26-14-8-7-12(22)20(33(24,30)31)15(14)21(29)32-2/h3-8,10,21,25-26,29H,9H2,1-2H3,(H2,24,30,31) |
| InChIKey | OTNRYWAOKBBJOW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.93 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|