C25H31N5O4S — CID 173479427
[3-[[4-(2,2-dimethyl-1-phenylpropyl)imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxyphenyl]-(3-hydroxypiperidin-1-yl)methanone (PubChem CID 173479427) has the molecular formula C25H31N5O4S and a molecular weight of 497.62 g/mol. Its IUPAC name is [3-[[4-(2,2-dimethyl-1-phenylpropyl)imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxyphenyl]-(3-hydroxypiperidin-1-yl)methanone.
| Compound Name | [3-[[4-(2,2-dimethyl-1-phenylpropyl)imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxyphenyl]-(3-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 173479427 |
| Molecular Formula | C25H31N5O4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | [3-[[4-(2,2-dimethyl-1-phenylpropyl)imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxyphenyl]-(3-hydroxypiperidin-1-yl)methanone |
| SMILES | CC(C)(C)C(/N=c1\[nH][s+]([O-])nc1Nc1cccc(C(=O)N2CCCC(O)C2)c1O)c1ccccc1 |
| InChI | InChI=1S/C25H31N5O4S/c1-25(2,3)21(16-9-5-4-6-10-16)27-23-22(28-35(34)29-23)26-19-13-7-12-18(20(19)32)24(33)30-14-8-11-17(31)15-30/h4-7,9-10,12-13,17,21,31-32H,8,11,14-15H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | XDNWTKXEYVUXPI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|